C23H24N4O3 — CID 68783766
[4-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]phenyl]methyl-propan-2-ylcarbamic acid (PubChem CID 68783766) has the molecular formula C23H24N4O3 and a molecular weight of 404.47 g/mol. Its IUPAC name is [4-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]phenyl]methyl-propan-2-ylcarbamic acid.
| Compound Name | [4-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]phenyl]methyl-propan-2-ylcarbamic acid |
|---|---|
| PubChem CID | 68783766 |
| Molecular Formula | C23H24N4O3 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [4-[(3-amino-6-phenyl-2-pyridinyl)carbamoyl]phenyl]methyl-propan-2-ylcarbamic acid |
| SMILES | CC(C)N(Cc1ccc(C(=O)Nc2nc(-c3ccccc3)ccc2N)cc1)C(=O)O |
| InChI | InChI=1S/C23H24N4O3/c1-15(2)27(23(29)30)14-16-8-10-18(11-9-16)22(28)26-21-19(24)12-13-20(25-21)17-6-4-3-5-7-17/h3-13,15H,14,24H2,1-2H3,(H,29,30)(H,25,26,28) |
| InChIKey | RDCQZIUTBWGBBZ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 108.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |