C28H40N4O3 — CID 58001102
tert-butyl N-[2-[[4-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]benzoyl]amino]phenyl]carbamate (PubChem CID 58001102) has the molecular formula C28H40N4O3 and a molecular weight of 480.65 g/mol. Its IUPAC name is tert-butyl N-[2-[[4-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]benzoyl]amino]phenyl]carbamate.
| Compound Name | tert-butyl N-[2-[[4-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]benzoyl]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 58001102 |
| Molecular Formula | C28H40N4O3 |
| Molecular Weight | 480.65 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | tert-butyl N-[2-[[4-[[3-(4-methylpiperidin-1-yl)propylamino]methyl]benzoyl]amino]phenyl]carbamate |
| SMILES | CC1CCN(CCCNCc2ccc(C(=O)Nc3ccccc3NC(=O)OC(C)(C)C)cc2)CC1 |
| InChI | InChI=1S/C28H40N4O3/c1-21-14-18-32(19-15-21)17-7-16-29-20-22-10-12-23(13-11-22)26(33)30-24-8-5-6-9-25(24)31-27(34)35-28(2,3)4/h5-6,8-13,21,29H,7,14-20H2,1-4H3,(H,30,33)(H,31,34) |
| InChIKey | UFWLVBHRBWMDGJ-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.65 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|