C9H18N4O3S2 — CID 105359297
3-amino-1,5-dimethyl-N-(3-methylsulfinylpropyl)pyrazole-4-sulfonamide (PubChem CID 105359297) has the molecular formula C9H18N4O3S2 and a molecular weight of 294.40 g/mol. Its IUPAC name is 3-amino-1,5-dimethyl-N-(3-methylsulfinylpropyl)pyrazole-4-sulfonamide.
| Compound Name | 3-amino-1,5-dimethyl-N-(3-methylsulfinylpropyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 105359297 |
| Molecular Formula | C9H18N4O3S2 |
| Molecular Weight | 294.40 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-amino-1,5-dimethyl-N-(3-methylsulfinylpropyl)pyrazole-4-sulfonamide |
| SMILES | Cc1c(S(=O)(=O)NCCCS(C)=O)c(N)nn1C |
| InChI | InChI=1S/C9H18N4O3S2/c1-7-8(9(10)12-13(7)2)18(15,16)11-5-4-6-17(3)14/h11H,4-6H2,1-3H3,(H2,10,12) |
| InChIKey | AAPRKPJZEMAYCT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.40 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|