C14H25N3O3S — CID 126821597
1,3,5-trimethyl-N-(7-oxooctyl)pyrazole-4-sulfonamide (PubChem CID 126821597) has the molecular formula C14H25N3O3S and a molecular weight of 315.44 g/mol. Its IUPAC name is 1,3,5-trimethyl-N-(7-oxooctyl)pyrazole-4-sulfonamide.
| Compound Name | 1,3,5-trimethyl-N-(7-oxooctyl)pyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 126821597 |
| Molecular Formula | C14H25N3O3S |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.16 |
| IUPAC Name | 1,3,5-trimethyl-N-(7-oxooctyl)pyrazole-4-sulfonamide |
| SMILES | CC(=O)CCCCCCNS(=O)(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C14H25N3O3S/c1-11(18)9-7-5-6-8-10-15-21(19,20)14-12(2)16-17(4)13(14)3/h15H,5-10H2,1-4H3 |
| InChIKey | OXJLDBJYSOYISV-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|