C12H23N3O2S — CID 115613419
N-(2-ethylbutyl)-1,3,5-trimethylpyrazole-4-sulfonamide (PubChem CID 115613419) has the molecular formula C12H23N3O2S and a molecular weight of 273.40 g/mol. Its IUPAC name is N-(2-ethylbutyl)-1,3,5-trimethylpyrazole-4-sulfonamide.
| Compound Name | N-(2-ethylbutyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115613419 |
| Molecular Formula | C12H23N3O2S |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | N-(2-ethylbutyl)-1,3,5-trimethylpyrazole-4-sulfonamide |
| SMILES | CCC(CC)CNS(=O)(=O)c1c(C)nn(C)c1C |
| InChI | InChI=1S/C12H23N3O2S/c1-6-11(7-2)8-13-18(16,17)12-9(3)14-15(5)10(12)4/h11,13H,6-8H2,1-5H3 |
| InChIKey | UHFGIURFSBXFOQ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |