C10H18N4O2S2 — CID 55030672
2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]butanethioamide (PubChem CID 55030672) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]butanethioamide.
| Compound Name | 2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]butanethioamide |
|---|---|
| PubChem CID | 55030672 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]butanethioamide |
| SMILES | CCC(NS(=O)(=O)c1c(C)nn(C)c1C)C(N)=S |
| InChI | InChI=1S/C10H18N4O2S2/c1-5-8(10(11)17)13-18(15,16)9-6(2)12-14(4)7(9)3/h8,13H,5H2,1-4H3,(H2,11,17) |
| InChIKey | XBONSDXDZZTWNL-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|