C12H23N5O3S — CID 76933181
2-ethyl-N'-hydroxy-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]butanimidamide (PubChem CID 76933181) has the molecular formula C12H23N5O3S and a molecular weight of 317.42 g/mol. Its IUPAC name is 2-ethyl-N'-hydroxy-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]butanimidamide.
| Compound Name | 2-ethyl-N'-hydroxy-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]butanimidamide |
|---|---|
| PubChem CID | 76933181 |
| Molecular Formula | C12H23N5O3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | 2-ethyl-N'-hydroxy-2-[(1,3,5-trimethylpyrazol-4-yl)sulfonylamino]butanimidamide |
| SMILES | CCC(CC)(NS(=O)(=O)c1c(C)nn(C)c1C)C(N)=NO |
| InChI | InChI=1S/C12H23N5O3S/c1-6-12(7-2,11(13)15-18)16-21(19,20)10-8(3)14-17(5)9(10)4/h16,18H,6-7H2,1-5H3,(H2,13,15) |
| InChIKey | LSLMTLZYQRZJMM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|