C11H21N5O3S — CID 79373579
2-ethyl-2-[(1-ethylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide (PubChem CID 79373579) has the molecular formula C11H21N5O3S and a molecular weight of 303.39 g/mol. Its IUPAC name is 2-ethyl-2-[(1-ethylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide.
| Compound Name | 2-ethyl-2-[(1-ethylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 79373579 |
| Molecular Formula | C11H21N5O3S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.14 |
| IUPAC Name | 2-ethyl-2-[(1-ethylimidazol-4-yl)sulfonylamino]-N'-hydroxybutanimidamide |
| SMILES | CCn1cnc(S(=O)(=O)NC(CC)(CC)C(N)=NO)c1 |
| InChI | InChI=1S/C11H21N5O3S/c1-4-11(5-2,10(12)14-17)15-20(18,19)9-7-16(6-3)8-13-9/h7-8,15,17H,4-6H2,1-3H3,(H2,12,14) |
| InChIKey | AJQJSURSMSIBLQ-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 122.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|