C13H21N3O3S — CID 77077374
2-ethyl-N'-hydroxy-2-[(2-methylphenyl)sulfonylamino]butanimidamide (PubChem CID 77077374) has the molecular formula C13H21N3O3S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-ethyl-N'-hydroxy-2-[(2-methylphenyl)sulfonylamino]butanimidamide.
| Compound Name | 2-ethyl-N'-hydroxy-2-[(2-methylphenyl)sulfonylamino]butanimidamide |
|---|---|
| PubChem CID | 77077374 |
| Molecular Formula | C13H21N3O3S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.13 |
| IUPAC Name | 2-ethyl-N'-hydroxy-2-[(2-methylphenyl)sulfonylamino]butanimidamide |
| SMILES | CCC(CC)(NS(=O)(=O)c1ccccc1C)C(N)=NO |
| InChI | InChI=1S/C13H21N3O3S/c1-4-13(5-2,12(14)15-17)16-20(18,19)11-9-7-6-8-10(11)3/h6-9,16-17H,4-5H2,1-3H3,(H2,14,15) |
| InChIKey | FYILJAZUSXAXRG-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|