C11H17FN4O3S — CID 76923070
2-ethyl-2-[(5-fluoro-3-pyridinyl)sulfonylamino]-N'-hydroxybutanimidamide (PubChem CID 76923070) has the molecular formula C11H17FN4O3S and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-ethyl-2-[(5-fluoro-3-pyridinyl)sulfonylamino]-N'-hydroxybutanimidamide.
| Compound Name | 2-ethyl-2-[(5-fluoro-3-pyridinyl)sulfonylamino]-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76923070 |
| Molecular Formula | C11H17FN4O3S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-ethyl-2-[(5-fluoro-3-pyridinyl)sulfonylamino]-N'-hydroxybutanimidamide |
| SMILES | CCC(CC)(NS(=O)(=O)c1cncc(F)c1)C(N)=NO |
| InChI | InChI=1S/C11H17FN4O3S/c1-3-11(4-2,10(13)15-17)16-20(18,19)9-5-8(12)6-14-7-9/h5-7,16-17H,3-4H2,1-2H3,(H2,13,15) |
| InChIKey | SEAYTBAYEMAIHA-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 117.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|