C13H21FN2O3S — CID 97325983
5-fluoro-N-[(2R)-2-hydroxy-2,5-dimethylhexyl]pyridine-3-sulfonamide (PubChem CID 97325983) has the molecular formula C13H21FN2O3S and a molecular weight of 304.39 g/mol. Its IUPAC name is 5-fluoro-N-[(2R)-2-hydroxy-2,5-dimethylhexyl]pyridine-3-sulfonamide.
| Compound Name | 5-fluoro-N-[(2R)-2-hydroxy-2,5-dimethylhexyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 97325983 |
| Molecular Formula | C13H21FN2O3S |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 5-fluoro-N-[(2R)-2-hydroxy-2,5-dimethylhexyl]pyridine-3-sulfonamide |
| SMILES | CC(C)CC[C@@](C)(O)CNS(=O)(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C13H21FN2O3S/c1-10(2)4-5-13(3,17)9-16-20(18,19)12-6-11(14)7-15-8-12/h6-8,10,16-17H,4-5,9H2,1-3H3/t13-/m1/s1 |
| InChIKey | IHCYADSQGBPCIP-CYBMUJFWSA-N |
| XLogP | 1.69 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |