C8H20N2O3S — CID 111450153
2-hydroxy-2,5-dimethyl-1-(sulfamoylamino)hexane (PubChem CID 111450153) has the molecular formula C8H20N2O3S and a molecular weight of 224.33 g/mol. Its IUPAC name is 2-hydroxy-2,5-dimethyl-1-(sulfamoylamino)hexane.
| Compound Name | 2-hydroxy-2,5-dimethyl-1-(sulfamoylamino)hexane |
|---|---|
| PubChem CID | 111450153 |
| Molecular Formula | C8H20N2O3S |
| Molecular Weight | 224.33 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 2-hydroxy-2,5-dimethyl-1-(sulfamoylamino)hexane |
| SMILES | CC(C)CCC(C)(O)CNS(N)(=O)=O |
| InChI | InChI=1S/C8H20N2O3S/c1-7(2)4-5-8(3,11)6-10-14(9,12)13/h7,10-11H,4-6H2,1-3H3,(H2,9,12,13) |
| InChIKey | CYIJVEBUIDIMAD-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.33 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |