C10H23NO3S — CID 66178797
N-(2-hydroxy-2,4-dimethylpentyl)propane-1-sulfonamide (PubChem CID 66178797) has the molecular formula C10H23NO3S and a molecular weight of 237.36 g/mol. Its IUPAC name is N-(2-hydroxy-2,4-dimethylpentyl)propane-1-sulfonamide.
| Compound Name | N-(2-hydroxy-2,4-dimethylpentyl)propane-1-sulfonamide |
|---|---|
| PubChem CID | 66178797 |
| Molecular Formula | C10H23NO3S |
| Molecular Weight | 237.36 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | N-(2-hydroxy-2,4-dimethylpentyl)propane-1-sulfonamide |
| SMILES | CCCS(=O)(=O)NCC(C)(O)CC(C)C |
| InChI | InChI=1S/C10H23NO3S/c1-5-6-15(13,14)11-8-10(4,12)7-9(2)3/h9,11-12H,5-8H2,1-4H3 |
| InChIKey | DWQMXXBUCCYGTQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |