C12H22F3NO2 — CID 111485192
4,4,4-trifluoro-N-(2-hydroxy-2,5-dimethylhexyl)butanamide (PubChem CID 111485192) has the molecular formula C12H22F3NO2 and a molecular weight of 269.31 g/mol. Its IUPAC name is 4,4,4-trifluoro-N-(2-hydroxy-2,5-dimethylhexyl)butanamide.
| Compound Name | 4,4,4-trifluoro-N-(2-hydroxy-2,5-dimethylhexyl)butanamide |
|---|---|
| PubChem CID | 111485192 |
| Molecular Formula | C12H22F3NO2 |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | 4,4,4-trifluoro-N-(2-hydroxy-2,5-dimethylhexyl)butanamide |
| SMILES | CC(C)CCC(C)(O)CNC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C12H22F3NO2/c1-9(2)4-6-11(3,18)8-16-10(17)5-7-12(13,14)15/h9,18H,4-8H2,1-3H3,(H,16,17) |
| InChIKey | KQIONYQBSAPBND-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |