C11H20F3NO2 — CID 103843928
N-[2-ethyl-2-(hydroxymethyl)butyl]-4,4,4-trifluorobutanamide (PubChem CID 103843928) has the molecular formula C11H20F3NO2 and a molecular weight of 255.28 g/mol. Its IUPAC name is N-[2-ethyl-2-(hydroxymethyl)butyl]-4,4,4-trifluorobutanamide.
| Compound Name | N-[2-ethyl-2-(hydroxymethyl)butyl]-4,4,4-trifluorobutanamide |
|---|---|
| PubChem CID | 103843928 |
| Molecular Formula | C11H20F3NO2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-[2-ethyl-2-(hydroxymethyl)butyl]-4,4,4-trifluorobutanamide |
| SMILES | CCC(CC)(CO)CNC(=O)CCC(F)(F)F |
| InChI | InChI=1S/C11H20F3NO2/c1-3-10(4-2,8-16)7-15-9(17)5-6-11(12,13)14/h16H,3-8H2,1-2H3,(H,15,17) |
| InChIKey | RITFTZYCDKHNDY-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |