C13H29ClN2O2 — CID 120563952
4-amino-N-(2,2-diethyl-4-hydroxybutyl)pentanamide;hydrochloride (PubChem CID 120563952) has the molecular formula C13H29ClN2O2 and a molecular weight of 280.84 g/mol. Its IUPAC name is 4-amino-N-(2,2-diethyl-4-hydroxybutyl)pentanamide;hydrochloride.
| Compound Name | 4-amino-N-(2,2-diethyl-4-hydroxybutyl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120563952 |
| Molecular Formula | C13H29ClN2O2 |
| Molecular Weight | 280.84 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 4-amino-N-(2,2-diethyl-4-hydroxybutyl)pentanamide;hydrochloride |
| SMILES | CCC(CC)(CCO)CNC(=O)CCC(C)N.Cl |
| InChI | InChI=1S/C13H28N2O2.ClH/c1-4-13(5-2,8-9-16)10-15-12(17)7-6-11(3)14;/h11,16H,4-10,14H2,1-3H3,(H,15,17);1H |
| InChIKey | FOSHDJDBCKLAAF-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.84 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |