C12H24F3NO — CID 115517280
2-ethyl-2-[(5,5,5-trifluoropentylamino)methyl]butan-1-ol (PubChem CID 115517280) has the molecular formula C12H24F3NO and a molecular weight of 255.32 g/mol. Its IUPAC name is 2-ethyl-2-[(5,5,5-trifluoropentylamino)methyl]butan-1-ol.
| Compound Name | 2-ethyl-2-[(5,5,5-trifluoropentylamino)methyl]butan-1-ol |
|---|---|
| PubChem CID | 115517280 |
| Molecular Formula | C12H24F3NO |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 2-ethyl-2-[(5,5,5-trifluoropentylamino)methyl]butan-1-ol |
| SMILES | CCC(CC)(CO)CNCCCCC(F)(F)F |
| InChI | InChI=1S/C12H24F3NO/c1-3-11(4-2,10-17)9-16-8-6-5-7-12(13,14)15/h16-17H,3-10H2,1-2H3 |
| InChIKey | GSMDSUKPPJUBEC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|