C13H29N3O2 — CID 106256717
4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 106256717) has the molecular formula C13H29N3O2 and a molecular weight of 259.39 g/mol. Its IUPAC name is 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 106256717 |
| Molecular Formula | C13H29N3O2 |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | 4-[[2-ethyl-2-(hydroxymethyl)butyl]amino]-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CCC(CC)(CO)CNCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C13H29N3O2/c1-5-13(6-2,10-17)9-15-8-7-12(3,4)11(14)16-18/h15,17-18H,5-10H2,1-4H3,(H2,14,16) |
| InChIKey | XZEGDHLLIAMVPR-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 90.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|