C10H23N3O2S — CID 104867132
4-(2-ethylsulfinylethylamino)-N'-hydroxy-2,2-dimethylbutanimidamide (PubChem CID 104867132) has the molecular formula C10H23N3O2S and a molecular weight of 249.38 g/mol. Its IUPAC name is 4-(2-ethylsulfinylethylamino)-N'-hydroxy-2,2-dimethylbutanimidamide.
| Compound Name | 4-(2-ethylsulfinylethylamino)-N'-hydroxy-2,2-dimethylbutanimidamide |
|---|---|
| PubChem CID | 104867132 |
| Molecular Formula | C10H23N3O2S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 4-(2-ethylsulfinylethylamino)-N'-hydroxy-2,2-dimethylbutanimidamide |
| SMILES | CCS(=O)CCNCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C10H23N3O2S/c1-4-16(15)8-7-12-6-5-10(2,3)9(11)13-14/h12,14H,4-8H2,1-3H3,(H2,11,13) |
| InChIKey | FYUYSRMZHJQKHW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|