C6H16N2OS — CID 130589076
N'-(2-ethylsulfinylethyl)ethane-1,2-diamine (PubChem CID 130589076) has the molecular formula C6H16N2OS and a molecular weight of 164.27 g/mol. Its IUPAC name is N'-(2-ethylsulfinylethyl)ethane-1,2-diamine.
| Compound Name | N'-(2-ethylsulfinylethyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 130589076 |
| Molecular Formula | C6H16N2OS |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.10 |
| IUPAC Name | N'-(2-ethylsulfinylethyl)ethane-1,2-diamine |
| SMILES | CCS(=O)CCNCCN |
| InChI | InChI=1S/C6H16N2OS/c1-2-10(9)6-5-8-4-3-7/h8H,2-7H2,1H3 |
| InChIKey | BFIDERPMNSDTOC-UHFFFAOYSA-N |
| XLogP | -0.70 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|