C5H14N2NaO2S- — CID 175369186
sodium;3-(2-aminoethylamino)propane-1-sulfinate;hydride (PubChem CID 175369186) has the molecular formula C5H14N2NaO2S- and a molecular weight of 189.24 g/mol. Its IUPAC name is sodium;3-(2-aminoethylamino)propane-1-sulfinate;hydride.
| Compound Name | sodium;3-(2-aminoethylamino)propane-1-sulfinate;hydride |
|---|---|
| PubChem CID | 175369186 |
| Molecular Formula | C5H14N2NaO2S- |
| Molecular Weight | 189.24 g/mol |
| Exact Mass | 189.07 |
| IUPAC Name | sodium;3-(2-aminoethylamino)propane-1-sulfinate;hydride |
| SMILES | NCCNCCCS(=O)[O-].[H-].[Na+] |
| InChI | InChI=1S/C5H14N2O2S.Na.H/c6-2-4-7-3-1-5-10(8)9;;/h7H,1-6H2,(H,8,9);;/q;+1;-1/p-1 |
| InChIKey | OPGXCGPKDFYZRU-UHFFFAOYSA-M |
| XLogP | -4.08 |
| TPSA | 78.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.24 |
| LogP ≤ 5 | -4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|