C4H11N2NaO3S — CID 23686675
sodium 2-(2-aminoethylamino)ethanesulfonate (PubChem CID 23686675) has the molecular formula C4H11N2NaO3S and a molecular weight of 190.20 g/mol. Its IUPAC name is sodium 2-(2-aminoethylamino)ethanesulfonate.
| Compound Name | sodium 2-(2-aminoethylamino)ethanesulfonate |
|---|---|
| PubChem CID | 23686675 |
| Molecular Formula | C4H11N2NaO3S |
| Molecular Weight | 190.20 g/mol |
| Exact Mass | 190.04 |
| IUPAC Name | sodium 2-(2-aminoethylamino)ethanesulfonate |
| SMILES | NCCNCCS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H12N2O3S.Na/c5-1-2-6-3-4-10(7,8)9;/h6H,1-5H2,(H,7,8,9);/q;+1/p-1 |
| InChIKey | VRRABDXZDGRGPC-UHFFFAOYSA-M |
| XLogP | -4.92 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.20 |
| LogP ≤ 5 | -4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|