C4H13N2NaO4S — CID 172552066
sodium;2-(2-aminoethylamino)ethanesulfonate;hydrate (PubChem CID 172552066) has the molecular formula C4H13N2NaO4S and a molecular weight of 208.21 g/mol. Its IUPAC name is sodium;2-(2-aminoethylamino)ethanesulfonate;hydrate.
| Compound Name | sodium;2-(2-aminoethylamino)ethanesulfonate;hydrate |
|---|---|
| PubChem CID | 172552066 |
| Molecular Formula | C4H13N2NaO4S |
| Molecular Weight | 208.21 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | sodium;2-(2-aminoethylamino)ethanesulfonate;hydrate |
| SMILES | NCCNCCS(=O)(=O)[O-].O.[Na+] |
| InChI | InChI=1S/C4H12N2O3S.Na.H2O/c5-1-2-6-3-4-10(7,8)9;;/h6H,1-5H2,(H,7,8,9);;1H2/q;+1;/p-1 |
| InChIKey | WTGYMZCKWOXGGQ-UHFFFAOYSA-M |
| XLogP | -5.74 |
| TPSA | 126.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.21 |
| LogP ≤ 5 | -5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|