C13H29N3O2S — CID 106711613
N'-hydroxy-2,2-dimethyl-6-(3-methylsulfinylbutylamino)hexanimidamide (PubChem CID 106711613) has the molecular formula C13H29N3O2S and a molecular weight of 291.46 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-(3-methylsulfinylbutylamino)hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-(3-methylsulfinylbutylamino)hexanimidamide |
|---|---|
| PubChem CID | 106711613 |
| Molecular Formula | C13H29N3O2S |
| Molecular Weight | 291.46 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-(3-methylsulfinylbutylamino)hexanimidamide |
| SMILES | CC(CCNCCCCC(C)(C)C(N)=NO)S(C)=O |
| InChI | InChI=1S/C13H29N3O2S/c1-11(19(4)18)7-10-15-9-6-5-8-13(2,3)12(14)16-17/h11,15,17H,5-10H2,1-4H3,(H2,14,16) |
| InChIKey | WROHIIVSKDPCRO-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 87.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.46 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|