C15H33N3O2 — CID 106011954
N'-hydroxy-2,2-dimethyl-6-(4-propan-2-yloxybutylamino)hexanimidamide (PubChem CID 106011954) has the molecular formula C15H33N3O2 and a molecular weight of 287.45 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-6-(4-propan-2-yloxybutylamino)hexanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-6-(4-propan-2-yloxybutylamino)hexanimidamide |
|---|---|
| PubChem CID | 106011954 |
| Molecular Formula | C15H33N3O2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-6-(4-propan-2-yloxybutylamino)hexanimidamide |
| SMILES | CC(C)OCCCCNCCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C15H33N3O2/c1-13(2)20-12-8-7-11-17-10-6-5-9-15(3,4)14(16)18-19/h13,17,19H,5-12H2,1-4H3,(H2,16,18) |
| InChIKey | QXSMCPSNKYTEHB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 79.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|