C15H33N3O3 — CID 106711583
N'-hydroxy-6-[4-(2-methoxyethoxy)butylamino]-2,2-dimethylhexanimidamide (PubChem CID 106711583) has the molecular formula C15H33N3O3 and a molecular weight of 303.45 g/mol. Its IUPAC name is N'-hydroxy-6-[4-(2-methoxyethoxy)butylamino]-2,2-dimethylhexanimidamide.
| Compound Name | N'-hydroxy-6-[4-(2-methoxyethoxy)butylamino]-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106711583 |
| Molecular Formula | C15H33N3O3 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.25 |
| IUPAC Name | N'-hydroxy-6-[4-(2-methoxyethoxy)butylamino]-2,2-dimethylhexanimidamide |
| SMILES | COCCOCCCCNCCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C15H33N3O3/c1-15(2,14(16)18-19)8-4-5-9-17-10-6-7-11-21-13-12-20-3/h17,19H,4-13H2,1-3H3,(H2,16,18) |
| InChIKey | FPYQKUSWMPNRIH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|