C14H30N2O2 — CID 106711866
6-(3,3-dimethylbutoxy)-N'-hydroxy-2,2-dimethylhexanimidamide (PubChem CID 106711866) has the molecular formula C14H30N2O2 and a molecular weight of 258.41 g/mol. Its IUPAC name is 6-(3,3-dimethylbutoxy)-N'-hydroxy-2,2-dimethylhexanimidamide.
| Compound Name | 6-(3,3-dimethylbutoxy)-N'-hydroxy-2,2-dimethylhexanimidamide |
|---|---|
| PubChem CID | 106711866 |
| Molecular Formula | C14H30N2O2 |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.23 |
| IUPAC Name | 6-(3,3-dimethylbutoxy)-N'-hydroxy-2,2-dimethylhexanimidamide |
| SMILES | CC(C)(C)CCOCCCCC(C)(C)C(N)=NO |
| InChI | InChI=1S/C14H30N2O2/c1-13(2,3)9-11-18-10-7-6-8-14(4,5)12(15)16-17/h17H,6-11H2,1-5H3,(H2,15,16) |
| InChIKey | LLRLIYGPQYBYCJ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 67.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|