C9H10ClFN2O4S — CID 103493492
methyl 2-chloro-3-[(5-fluoro-3-pyridinyl)sulfonylamino]propanoate (PubChem CID 103493492) has the molecular formula C9H10ClFN2O4S and a molecular weight of 296.71 g/mol. Its IUPAC name is methyl 2-chloro-3-[(5-fluoro-3-pyridinyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-chloro-3-[(5-fluoro-3-pyridinyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 103493492 |
| Molecular Formula | C9H10ClFN2O4S |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | methyl 2-chloro-3-[(5-fluoro-3-pyridinyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(Cl)CNS(=O)(=O)c1cncc(F)c1 |
| InChI | InChI=1S/C9H10ClFN2O4S/c1-17-9(14)8(10)5-13-18(15,16)7-2-6(11)3-12-4-7/h2-4,8,13H,5H2,1H3 |
| InChIKey | RJOBCKBHQSFIBS-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|