C12H16ClNO4S — CID 103493569
methyl 2-chloro-3-[(3,4-dimethylphenyl)sulfonylamino]propanoate (PubChem CID 103493569) has the molecular formula C12H16ClNO4S and a molecular weight of 305.78 g/mol. Its IUPAC name is methyl 2-chloro-3-[(3,4-dimethylphenyl)sulfonylamino]propanoate.
| Compound Name | methyl 2-chloro-3-[(3,4-dimethylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 103493569 |
| Molecular Formula | C12H16ClNO4S |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | methyl 2-chloro-3-[(3,4-dimethylphenyl)sulfonylamino]propanoate |
| SMILES | COC(=O)C(Cl)CNS(=O)(=O)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C12H16ClNO4S/c1-8-4-5-10(6-9(8)2)19(16,17)14-7-11(13)12(15)18-3/h4-6,11,14H,7H2,1-3H3 |
| InChIKey | OEYXBGYFFVPRTP-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|