C13H20BrNO2S — CID 114295021
N-(4-bromo-2-methylbutyl)-3,4-dimethylbenzenesulfonamide (PubChem CID 114295021) has the molecular formula C13H20BrNO2S and a molecular weight of 334.28 g/mol. Its IUPAC name is N-(4-bromo-2-methylbutyl)-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-(4-bromo-2-methylbutyl)-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 114295021 |
| Molecular Formula | C13H20BrNO2S |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | N-(4-bromo-2-methylbutyl)-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC(C)CCBr)cc1C |
| InChI | InChI=1S/C13H20BrNO2S/c1-10(6-7-14)9-15-18(16,17)13-5-4-11(2)12(3)8-13/h4-5,8,10,15H,6-7,9H2,1-3H3 |
| InChIKey | OFMIHQWSVPABCT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|