C15H24BrNO2S — CID 106356653
N-(1-bromo-4,4-dimethylpentan-3-yl)-3,4-dimethylbenzenesulfonamide (PubChem CID 106356653) has the molecular formula C15H24BrNO2S and a molecular weight of 362.33 g/mol. Its IUPAC name is N-(1-bromo-4,4-dimethylpentan-3-yl)-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 106356653 |
| Molecular Formula | C15H24BrNO2S |
| Molecular Weight | 362.33 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC(CCBr)C(C)(C)C)cc1C |
| InChI | InChI=1S/C15H24BrNO2S/c1-11-6-7-13(10-12(11)2)20(18,19)17-14(8-9-16)15(3,4)5/h6-7,10,14,17H,8-9H2,1-5H3 |
| InChIKey | AXQUUCPSNWJQPY-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.33 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|