C14H22BrNO2S — CID 106356635
N-(1-bromo-4,4-dimethylpentan-3-yl)-3-methylbenzenesulfonamide (PubChem CID 106356635) has the molecular formula C14H22BrNO2S and a molecular weight of 348.31 g/mol. Its IUPAC name is N-(1-bromo-4,4-dimethylpentan-3-yl)-3-methylbenzenesulfonamide.
| Compound Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 106356635 |
| Molecular Formula | C14H22BrNO2S |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | N-(1-bromo-4,4-dimethylpentan-3-yl)-3-methylbenzenesulfonamide |
| SMILES | Cc1cccc(S(=O)(=O)NC(CCBr)C(C)(C)C)c1 |
| InChI | InChI=1S/C14H22BrNO2S/c1-11-6-5-7-12(10-11)19(17,18)16-13(8-9-15)14(2,3)4/h5-7,10,13,16H,8-9H2,1-4H3 |
| InChIKey | KTVYLFPXFKIZST-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|