C14H22BrNO3S — CID 106353477
4-(bromomethyl)-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide (PubChem CID 106353477) has the molecular formula C14H22BrNO3S and a molecular weight of 364.31 g/mol. Its IUPAC name is 4-(bromomethyl)-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide.
| Compound Name | 4-(bromomethyl)-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106353477 |
| Molecular Formula | C14H22BrNO3S |
| Molecular Weight | 364.31 g/mol |
| Exact Mass | 363.05 |
| IUPAC Name | 4-(bromomethyl)-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide |
| SMILES | CC(C)(C)C(CCO)NS(=O)(=O)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H22BrNO3S/c1-14(2,3)13(8-9-17)16-20(18,19)12-6-4-11(10-15)5-7-12/h4-7,13,16-17H,8-10H2,1-3H3 |
| InChIKey | LVXIRDDKQARVBI-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.31 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|