C13H18F3NO3S — CID 103833824
2,3,4-trifluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide (PubChem CID 103833824) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is 2,3,4-trifluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide.
| Compound Name | 2,3,4-trifluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103833824 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | 2,3,4-trifluoro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide |
| SMILES | CC(C)(C)C(CCO)NS(=O)(=O)c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C13H18F3NO3S/c1-13(2,3)10(6-7-18)17-21(19,20)9-5-4-8(14)11(15)12(9)16/h4-5,10,17-18H,6-7H2,1-3H3 |
| InChIKey | PTKZGZOOGGRILM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|