C13H19Br2NO3S — CID 103833752
2,5-dibromo-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide (PubChem CID 103833752) has the molecular formula C13H19Br2NO3S and a molecular weight of 429.17 g/mol. Its IUPAC name is 2,5-dibromo-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide.
| Compound Name | 2,5-dibromo-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 103833752 |
| Molecular Formula | C13H19Br2NO3S |
| Molecular Weight | 429.17 g/mol |
| Exact Mass | 426.95 |
| IUPAC Name | 2,5-dibromo-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide |
| SMILES | CC(C)(C)C(CCO)NS(=O)(=O)c1cc(Br)ccc1Br |
| InChI | InChI=1S/C13H19Br2NO3S/c1-13(2,3)12(6-7-17)16-20(18,19)11-8-9(14)4-5-10(11)15/h4-5,8,12,16-17H,6-7H2,1-3H3 |
| InChIKey | CRWVIGKZXMESQE-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.17 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |