C13H21ClN2O3S — CID 106348107
2-amino-5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide (PubChem CID 106348107) has the molecular formula C13H21ClN2O3S and a molecular weight of 320.84 g/mol. Its IUPAC name is 2-amino-5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide.
| Compound Name | 2-amino-5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106348107 |
| Molecular Formula | C13H21ClN2O3S |
| Molecular Weight | 320.84 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | 2-amino-5-chloro-N-(1-hydroxy-4,4-dimethylpentan-3-yl)benzenesulfonamide |
| SMILES | CC(C)(C)C(CCO)NS(=O)(=O)c1cc(Cl)ccc1N |
| InChI | InChI=1S/C13H21ClN2O3S/c1-13(2,3)12(6-7-17)16-20(18,19)11-8-9(14)4-5-10(11)15/h4-5,8,12,16-17H,6-7,15H2,1-3H3 |
| InChIKey | PWCZYQNLQRITDW-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.84 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|