C13H18Cl3NO2S — CID 106356551
2,5-dichloro-N-(1-chloro-4,4-dimethylpentan-3-yl)benzenesulfonamide (PubChem CID 106356551) has the molecular formula C13H18Cl3NO2S and a molecular weight of 358.72 g/mol. Its IUPAC name is 2,5-dichloro-N-(1-chloro-4,4-dimethylpentan-3-yl)benzenesulfonamide.
| Compound Name | 2,5-dichloro-N-(1-chloro-4,4-dimethylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106356551 |
| Molecular Formula | C13H18Cl3NO2S |
| Molecular Weight | 358.72 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 2,5-dichloro-N-(1-chloro-4,4-dimethylpentan-3-yl)benzenesulfonamide |
| SMILES | CC(C)(C)C(CCCl)NS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C13H18Cl3NO2S/c1-13(2,3)12(6-7-14)17-20(18,19)11-8-9(15)4-5-10(11)16/h4-5,8,12,17H,6-7H2,1-3H3 |
| InChIKey | KVEDWCZUWPJWNA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.72 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|