C13H19BrClNO2S — CID 114178076
4-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)benzenesulfonamide (PubChem CID 114178076) has the molecular formula C13H19BrClNO2S and a molecular weight of 368.72 g/mol. Its IUPAC name is 4-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)benzenesulfonamide.
| Compound Name | 4-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 114178076 |
| Molecular Formula | C13H19BrClNO2S |
| Molecular Weight | 368.72 g/mol |
| Exact Mass | 367.00 |
| IUPAC Name | 4-bromo-N-(1-chloro-4,4-dimethylpentan-3-yl)benzenesulfonamide |
| SMILES | CC(C)(C)C(CCCl)NS(=O)(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C13H19BrClNO2S/c1-13(2,3)12(8-9-15)16-19(17,18)11-6-4-10(14)5-7-11/h4-7,12,16H,8-9H2,1-3H3 |
| InChIKey | XDEWNXMNPYPOEL-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.72 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|