C12H18ClNO3S — CID 21078717
4-chloro-N-(1-hydroxy-3,3-dimethylbutan-2-yl)benzenesulfonamide (PubChem CID 21078717) has the molecular formula C12H18ClNO3S and a molecular weight of 291.80 g/mol. Its IUPAC name is 4-chloro-N-(1-hydroxy-3,3-dimethylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(1-hydroxy-3,3-dimethylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 21078717 |
| Molecular Formula | C12H18ClNO3S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 4-chloro-N-(1-hydroxy-3,3-dimethylbutan-2-yl)benzenesulfonamide |
| SMILES | CC(C)(C)C(CO)NS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H18ClNO3S/c1-12(2,3)11(8-15)14-18(16,17)10-6-4-9(13)5-7-10/h4-7,11,14-15H,8H2,1-3H3 |
| InChIKey | GAVZPZUJCRTQNY-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |