C8H7Cl4NO3S — CID 3745238
4-chloro-N-(2,2,2-trichloro-1-hydroxyethyl)benzenesulfonamide (PubChem CID 3745238) has the molecular formula C8H7Cl4NO3S and a molecular weight of 339.03 g/mol. Its IUPAC name is 4-chloro-N-(2,2,2-trichloro-1-hydroxyethyl)benzenesulfonamide.
| Compound Name | 4-chloro-N-(2,2,2-trichloro-1-hydroxyethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 3745238 |
| Molecular Formula | C8H7Cl4NO3S |
| Molecular Weight | 339.03 g/mol |
| Exact Mass | 336.89 |
| IUPAC Name | 4-chloro-N-(2,2,2-trichloro-1-hydroxyethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NC(O)C(Cl)(Cl)Cl)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C8H7Cl4NO3S/c9-5-1-3-6(4-2-5)17(15,16)13-7(14)8(10,11)12/h1-4,7,13-14H |
| InChIKey | XWQGLADYHNQVGZ-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.03 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|