C16H15Cl3N2O2S2 — CID 11189825
N-[2,2-dichloro-1-[(4-chlorophenyl)sulfonylamino]-2-phenylethyl]ethanethioamide (PubChem CID 11189825) has the molecular formula C16H15Cl3N2O2S2 and a molecular weight of 437.80 g/mol. Its IUPAC name is N-[2,2-dichloro-1-[(4-chlorophenyl)sulfonylamino]-2-phenylethyl]ethanethioamide.
| Compound Name | N-[2,2-dichloro-1-[(4-chlorophenyl)sulfonylamino]-2-phenylethyl]ethanethioamide |
|---|---|
| PubChem CID | 11189825 |
| Molecular Formula | C16H15Cl3N2O2S2 |
| Molecular Weight | 437.80 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | N-[2,2-dichloro-1-[(4-chlorophenyl)sulfonylamino]-2-phenylethyl]ethanethioamide |
| SMILES | CC(=S)NC(NS(=O)(=O)c1ccc(Cl)cc1)C(Cl)(Cl)c1ccccc1 |
| InChI | InChI=1S/C16H15Cl3N2O2S2/c1-11(24)20-15(16(18,19)12-5-3-2-4-6-12)21-25(22,23)14-9-7-13(17)8-10-14/h2-10,15,21H,1H3,(H,20,24) |
| InChIKey | GDVPNJIPIHXVMM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.80 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|