C17H16ClNO3S — CID 102434392
N-[(1R)-1-(4-chlorophenyl)-2-methylidene-3-oxobutyl]benzenesulfonamide (PubChem CID 102434392) has the molecular formula C17H16ClNO3S and a molecular weight of 349.84 g/mol. Its IUPAC name is N-[(1R)-1-(4-chlorophenyl)-2-methylidene-3-oxobutyl]benzenesulfonamide.
| Compound Name | N-[(1R)-1-(4-chlorophenyl)-2-methylidene-3-oxobutyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102434392 |
| Molecular Formula | C17H16ClNO3S |
| Molecular Weight | 349.84 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | N-[(1R)-1-(4-chlorophenyl)-2-methylidene-3-oxobutyl]benzenesulfonamide |
| SMILES | C=C(C(C)=O)[C@H](NS(=O)(=O)c1ccccc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H16ClNO3S/c1-12(13(2)20)17(14-8-10-15(18)11-9-14)19-23(21,22)16-6-4-3-5-7-16/h3-11,17,19H,1H2,2H3/t17-/m0/s1 |
| InChIKey | SDPYRTYDXMVCQX-KRWDZBQOSA-N |
| XLogP | 3.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.84 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|