C25H25NO3S — CID 10927925
N-[2-benzoyl-1-(4-ethylphenyl)prop-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 10927925) has the molecular formula C25H25NO3S and a molecular weight of 419.55 g/mol. Its IUPAC name is N-[2-benzoyl-1-(4-ethylphenyl)prop-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-benzoyl-1-(4-ethylphenyl)prop-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10927925 |
| Molecular Formula | C25H25NO3S |
| Molecular Weight | 419.55 g/mol |
| Exact Mass | 419.16 |
| IUPAC Name | N-[2-benzoyl-1-(4-ethylphenyl)prop-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | C=C(C(=O)c1ccccc1)C(NS(=O)(=O)c1ccc(C)cc1)c1ccc(CC)cc1 |
| InChI | InChI=1S/C25H25NO3S/c1-4-20-12-14-21(15-13-20)24(19(3)25(27)22-8-6-5-7-9-22)26-30(28,29)23-16-10-18(2)11-17-23/h5-17,24,26H,3-4H2,1-2H3 |
| InChIKey | MMYXHPNVIXKWHC-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.55 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|