C25H24ClNO3S — CID 46844306
N-[(Z)-2-(4-chlorobenzoyl)-1-phenylpent-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 46844306) has the molecular formula C25H24ClNO3S and a molecular weight of 453.99 g/mol. Its IUPAC name is N-[(Z)-2-(4-chlorobenzoyl)-1-phenylpent-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-2-(4-chlorobenzoyl)-1-phenylpent-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46844306 |
| Molecular Formula | C25H24ClNO3S |
| Molecular Weight | 453.99 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[(Z)-2-(4-chlorobenzoyl)-1-phenylpent-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | CC/C=C(\C(=O)c1ccc(Cl)cc1)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C25H24ClNO3S/c1-3-7-23(25(28)20-12-14-21(26)15-13-20)24(19-8-5-4-6-9-19)27-31(29,30)22-16-10-18(2)11-17-22/h4-17,24,27H,3H2,1-2H3/b23-7- |
| InChIKey | XONQFCIVIWULBX-FINSYCMTSA-N |
| XLogP | 5.89 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.99 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|