C26H27NO4S — CID 46844305
N-[(Z)-2-(4-methoxybenzoyl)-1-phenylpent-2-enyl]-4-methylbenzenesulfonamide (PubChem CID 46844305) has the molecular formula C26H27NO4S and a molecular weight of 449.57 g/mol. Its IUPAC name is N-[(Z)-2-(4-methoxybenzoyl)-1-phenylpent-2-enyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(Z)-2-(4-methoxybenzoyl)-1-phenylpent-2-enyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 46844305 |
| Molecular Formula | C26H27NO4S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.17 |
| IUPAC Name | N-[(Z)-2-(4-methoxybenzoyl)-1-phenylpent-2-enyl]-4-methylbenzenesulfonamide |
| SMILES | CC/C=C(\C(=O)c1ccc(OC)cc1)C(NS(=O)(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C26H27NO4S/c1-4-8-24(26(28)21-13-15-22(31-3)16-14-21)25(20-9-6-5-7-10-20)27-32(29,30)23-17-11-19(2)12-18-23/h5-18,25,27H,4H2,1-3H3/b24-8- |
| InChIKey | MUOSAMMYPFVSBO-GYRAYZOKSA-N |
| XLogP | 5.24 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|