C35H37NO3S — CID 164671768
N-[(1R,2Z)-3-(4-methoxyphenyl)-2-(2-methyl-3-phenylpropyl)-1-phenylpenta-2,4-dienyl]-4-methylbenzenesulfonamide (PubChem CID 164671768) has the molecular formula C35H37NO3S and a molecular weight of 551.75 g/mol. Its IUPAC name is N-[(1R,2Z)-3-(4-methoxyphenyl)-2-(2-methyl-3-phenylpropyl)-1-phenylpenta-2,4-dienyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(1R,2Z)-3-(4-methoxyphenyl)-2-(2-methyl-3-phenylpropyl)-1-phenylpenta-2,4-dienyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164671768 |
| Molecular Formula | C35H37NO3S |
| Molecular Weight | 551.75 g/mol |
| Exact Mass | 551.25 |
| IUPAC Name | N-[(1R,2Z)-3-(4-methoxyphenyl)-2-(2-methyl-3-phenylpropyl)-1-phenylpenta-2,4-dienyl]-4-methylbenzenesulfonamide |
| SMILES | C=C/C(=C(\CC(C)Cc1ccccc1)[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1)c1ccc(OC)cc1 |
| InChI | InChI=1S/C35H37NO3S/c1-5-33(29-18-20-31(39-4)21-19-29)34(25-27(3)24-28-12-8-6-9-13-28)35(30-14-10-7-11-15-30)36-40(37,38)32-22-16-26(2)17-23-32/h5-23,27,35-36H,1,24-25H2,2-4H3/b34-33-/t27?,35-/m1/s1 |
| InChIKey | DVCMQCYMGVZZBC-ZMLJJUEGSA-N |
| XLogP | 7.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.75 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|