C28H29NO7S — CID 102224653
dimethyl 2-[(E,1R)-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-1-phenylprop-2-enyl]propanedioate (PubChem CID 102224653) has the molecular formula C28H29NO7S and a molecular weight of 523.61 g/mol. Its IUPAC name is dimethyl 2-[(E,1R)-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-1-phenylprop-2-enyl]propanedioate.
| Compound Name | dimethyl 2-[(E,1R)-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-1-phenylprop-2-enyl]propanedioate |
|---|---|
| PubChem CID | 102224653 |
| Molecular Formula | C28H29NO7S |
| Molecular Weight | 523.61 g/mol |
| Exact Mass | 523.17 |
| IUPAC Name | dimethyl 2-[(E,1R)-3-(4-methoxyphenyl)-3-[(4-methylphenyl)sulfonylamino]-1-phenylprop-2-enyl]propanedioate |
| SMILES | COC(=O)C(C(=O)OC)[C@@H](/C=C(/NS(=O)(=O)c1ccc(C)cc1)c1ccc(OC)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H29NO7S/c1-19-10-16-23(17-11-19)37(32,33)29-25(21-12-14-22(34-2)15-13-21)18-24(20-8-6-5-7-9-20)26(27(30)35-3)28(31)36-4/h5-18,24,26,29H,1-4H3/b25-18+/t24-/m0/s1 |
| InChIKey | JZVUNSMHKCDYMK-XSICDPOBSA-N |
| XLogP | 4.07 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.61 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|