C23H23NO4S — CID 122398695
N-[2,2-bis(4-methoxyphenyl)ethenyl]-4-methylbenzenesulfonamide (PubChem CID 122398695) has the molecular formula C23H23NO4S and a molecular weight of 409.51 g/mol. Its IUPAC name is N-[2,2-bis(4-methoxyphenyl)ethenyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2,2-bis(4-methoxyphenyl)ethenyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 122398695 |
| Molecular Formula | C23H23NO4S |
| Molecular Weight | 409.51 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[2,2-bis(4-methoxyphenyl)ethenyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc(C(=CNS(=O)(=O)c2ccc(C)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C23H23NO4S/c1-17-4-14-22(15-5-17)29(25,26)24-16-23(18-6-10-20(27-2)11-7-18)19-8-12-21(28-3)13-9-19/h4-16,24H,1-3H3 |
| InChIKey | SATGQOBKMPXIFV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.51 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |