C13H17NO3S — CID 70074823
4-methoxy-N-(2-methylpenta-1,4-dienyl)benzenesulfonamide (PubChem CID 70074823) has the molecular formula C13H17NO3S and a molecular weight of 267.35 g/mol. Its IUPAC name is 4-methoxy-N-(2-methylpenta-1,4-dienyl)benzenesulfonamide.
| Compound Name | 4-methoxy-N-(2-methylpenta-1,4-dienyl)benzenesulfonamide |
|---|---|
| PubChem CID | 70074823 |
| Molecular Formula | C13H17NO3S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.09 |
| IUPAC Name | 4-methoxy-N-(2-methylpenta-1,4-dienyl)benzenesulfonamide |
| SMILES | C=CCC(C)=CNS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H17NO3S/c1-4-5-11(2)10-14-18(15,16)13-8-6-12(17-3)7-9-13/h4,6-10,14H,1,5H2,2-3H3 |
| InChIKey | BDRIIPLVFHFCNH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|