C14H17NO7S — CID 142645675
(3R)-3-[(4-methoxyphenyl)sulfonylamino]-4-oxo-4-prop-2-enoxybutanoic acid (PubChem CID 142645675) has the molecular formula C14H17NO7S and a molecular weight of 343.36 g/mol. Its IUPAC name is (3R)-3-[(4-methoxyphenyl)sulfonylamino]-4-oxo-4-prop-2-enoxybutanoic acid.
| Compound Name | (3R)-3-[(4-methoxyphenyl)sulfonylamino]-4-oxo-4-prop-2-enoxybutanoic acid |
|---|---|
| PubChem CID | 142645675 |
| Molecular Formula | C14H17NO7S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | (3R)-3-[(4-methoxyphenyl)sulfonylamino]-4-oxo-4-prop-2-enoxybutanoic acid |
| SMILES | C=CCOC(=O)[C@@H](CC(=O)O)NS(=O)(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C14H17NO7S/c1-3-8-22-14(18)12(9-13(16)17)15-23(19,20)11-6-4-10(21-2)5-7-11/h3-7,12,15H,1,8-9H2,2H3,(H,16,17)/t12-/m1/s1 |
| InChIKey | UUGMKFUEPAXYAC-GFCCVEGCSA-N |
| XLogP | 0.55 |
| TPSA | 119.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|